| Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
| CAS NO: |
608-66-2 |
| EC NO: |
210-165-2 |
| Molecular Formula: |
C6H14O6 |
| Molecular Weight: |
182.1718 |
| Specification: |
|
| InChI: |
InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6+ |
| Packing: |
Bottle of kg. 10 |
Product description:
Sorbitol is a sugar alcohol. It has two thirds the calories of sugar, and is not as sweet (60% as sweet as sugar). It is poorly absorbed by the body, so it does not raise insulin levels as much as sugar. It does not promote tooth decay. |
| Synonyms: |
Galactitol;dulcitol for microbiology;Dulcitol (1.03589);DULCITE;D-galactitol;D-allitol; |
| Molecular Structure: |
|